C23H24F3N5OS — CID 164558131
3-(methylsulfanylamino)-N-[4-[[2-(trifluoromethyl)imidazo[1,2-a]pyridin-5-yl]amino]cyclohept-4-en-1-yl]benzamide (PubChem CID 164558131) has the molecular formula C23H24F3N5OS and a molecular weight of 475.54 g/mol. Its IUPAC name is 3-(methylsulfanylamino)-N-[4-[[2-(trifluoromethyl)imidazo[1,2-a]pyridin-5-yl]amino]cyclohept-4-en-1-yl]benzamide.
| Compound Name | 3-(methylsulfanylamino)-N-[4-[[2-(trifluoromethyl)imidazo[1,2-a]pyridin-5-yl]amino]cyclohept-4-en-1-yl]benzamide |
|---|---|
| PubChem CID | 164558131 |
| Molecular Formula | C23H24F3N5OS |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 3-(methylsulfanylamino)-N-[4-[[2-(trifluoromethyl)imidazo[1,2-a]pyridin-5-yl]amino]cyclohept-4-en-1-yl]benzamide |
| SMILES | CSNc1cccc(C(=O)NC2CCC=C(Nc3cccc4nc(C(F)(F)F)cn34)CC2)c1 |
| InChI | InChI=1S/C23H24F3N5OS/c1-33-30-18-8-2-5-15(13-18)22(32)28-17-7-3-6-16(11-12-17)27-20-9-4-10-21-29-19(14-31(20)21)23(24,25)26/h2,4-6,8-10,13-14,17,27,30H,3,7,11-12H2,1H3,(H,28,32) |
| InChIKey | IYQMBPJJFFCDLF-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|