C15H22F3NO2 — CID 164558740
ethane;1-(oxolan-3-yl)-3-propan-2-yl-5-(trifluoromethyl)pyridin-2-one (PubChem CID 164558740) has the molecular formula C15H22F3NO2 and a molecular weight of 305.34 g/mol. Its IUPAC name is ethane;1-(oxolan-3-yl)-3-propan-2-yl-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | ethane;1-(oxolan-3-yl)-3-propan-2-yl-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 164558740 |
| Molecular Formula | C15H22F3NO2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | ethane;1-(oxolan-3-yl)-3-propan-2-yl-5-(trifluoromethyl)pyridin-2-one |
| SMILES | CC.CC(C)c1cc(C(F)(F)F)cn(C2CCOC2)c1=O |
| InChI | InChI=1S/C13H16F3NO2.C2H6/c1-8(2)11-5-9(13(14,15)16)6-17(12(11)18)10-3-4-19-7-10;1-2/h5-6,8,10H,3-4,7H2,1-2H3;1-2H3 |
| InChIKey | UVYXPRIFONVYBI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |