C24H24FNO2 — CID 164560588
methyl (3R)-1-[5-[2-(3-fluorophenyl)ethynyl]-2,3-dihydro-1H-inden-1-yl]piperidine-3-carboxylate (PubChem CID 164560588) has the molecular formula C24H24FNO2 and a molecular weight of 377.46 g/mol. Its IUPAC name is methyl (3R)-1-[5-[2-(3-fluorophenyl)ethynyl]-2,3-dihydro-1H-inden-1-yl]piperidine-3-carboxylate.
| Compound Name | methyl (3R)-1-[5-[2-(3-fluorophenyl)ethynyl]-2,3-dihydro-1H-inden-1-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 164560588 |
| Molecular Formula | C24H24FNO2 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | methyl (3R)-1-[5-[2-(3-fluorophenyl)ethynyl]-2,3-dihydro-1H-inden-1-yl]piperidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN(C2CCc3cc(C#Cc4cccc(F)c4)ccc32)C1 |
| InChI | InChI=1S/C24H24FNO2/c1-28-24(27)20-5-3-13-26(16-20)23-12-10-19-14-18(9-11-22(19)23)8-7-17-4-2-6-21(25)15-17/h2,4,6,9,11,14-15,20,23H,3,5,10,12-13,16H2,1H3/t20-,23?/m1/s1 |
| InChIKey | UXCDFQZLFOJXFL-PPUHSXQSSA-N |
| XLogP | 4.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|