C23H22FNO2 — CID 164560580
(2S)-1-[5-[2-(3-fluorophenyl)ethynyl]-2,3-dihydro-1H-inden-1-yl]piperidine-2-carboxylic acid (PubChem CID 164560580) has the molecular formula C23H22FNO2 and a molecular weight of 363.43 g/mol. Its IUPAC name is (2S)-1-[5-[2-(3-fluorophenyl)ethynyl]-2,3-dihydro-1H-inden-1-yl]piperidine-2-carboxylic acid.
| Compound Name | (2S)-1-[5-[2-(3-fluorophenyl)ethynyl]-2,3-dihydro-1H-inden-1-yl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 164560580 |
| Molecular Formula | C23H22FNO2 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | (2S)-1-[5-[2-(3-fluorophenyl)ethynyl]-2,3-dihydro-1H-inden-1-yl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCCN1C1CCc2cc(C#Cc3cccc(F)c3)ccc21 |
| InChI | InChI=1S/C23H22FNO2/c24-19-5-3-4-16(15-19)7-8-17-9-11-20-18(14-17)10-12-21(20)25-13-2-1-6-22(25)23(26)27/h3-5,9,11,14-15,21-22H,1-2,6,10,12-13H2,(H,26,27)/t21?,22-/m0/s1 |
| InChIKey | UJEOCOWBARTBBC-KEKNWZKVSA-N |
| XLogP | 4.15 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|