About tert-butyl N-propan-2-ylethanimidate;ethane;2-methylpropane
tert-butyl N-propan-2-ylethanimidate;ethane;2-methylpropane (PubChem CID 164563435) has the molecular formula C15H35NO
and a molecular weight of 245.45 g/mol. Its IUPAC name is tert-butyl N-propan-2-ylethanimidate;ethane;2-methylpropane.
Molecular Properties
| Compound Name | tert-butyl N-propan-2-ylethanimidate;ethane;2-methylpropane |
| PubChem CID | 164563435 |
| Molecular Formula | C15H35NO |
| Molecular Weight | 245.45 g/mol |
| Exact Mass | 245.27 |
| IUPAC Name | tert-butyl N-propan-2-ylethanimidate;ethane;2-methylpropane |
| SMILES | C/C(=N\C(C)C)OC(C)(C)C.CC.CC(C)C |
| InChI | InChI=1S/C9H19NO.C4H10.C2H6/c1-7(2)10-8(3)11-9(4,5)6;1-4(2)3;1-2/h7H,1-6H3;4H,1-3H3;1-2H3/b10-8+;; |
| InChIKey | VIKZJNHCRPGPKL-PIHABLKOSA-N |
| XLogP | 5.32 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 245.45 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-propan-2-ylethanimidate;ethane;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-propan-2-ylethanimidate;ethane;2-methylpropane?
The IUPAC name of tert-butyl N-propan-2-ylethanimidate;ethane;2-methylpropane (CID 164563435) is tert-butyl N-propan-2-ylethanimidate;ethane;2-methylpropane.
What is the SMILES notation for tert-butyl N-propan-2-ylethanimidate;ethane;2-methylpropane?
The canonical SMILES for tert-butyl N-propan-2-ylethanimidate;ethane;2-methylpropane is C/C(=N\C(C)C)OC(C)(C)C.CC.CC(C)C.
What is the InChIKey of tert-butyl N-propan-2-ylethanimidate;ethane;2-methylpropane?
The InChIKey is VIKZJNHCRPGPKL-PIHABLKOSA-N. The full InChI is InChI=1S/C9H19NO.C4H10.C2H6/c1-7(2)10-8(3)11-9(4,5)6;1-4(2)3;1-2/h7H,1-6H3;4H,1-3H3;1-2H3/b10-8+;;.
What are the key properties of tert-butyl N-propan-2-ylethanimidate;ethane;2-methylpropane?
tert-butyl N-propan-2-ylethanimidate;ethane;2-methylpropane has a molecular weight of 245.45 g/mol, XLogP of 5.32, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-propan-2-ylethanimidate;ethane;2-methylpropane is sourced from PubChem (CID 164563435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).