About CID 164564366
CID 164564366 (PubChem CID 164564366) has the molecular formula C7H4BN3O2
and a molecular weight of 172.94 g/mol.
Molecular Properties
| Compound Name | CID 164564366 |
| PubChem CID | 164564366 |
| Molecular Formula | C7H4BN3O2 |
| Molecular Weight | 172.94 g/mol |
| Exact Mass | 173.04 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C(=O)O)c2n[nH]nc2c1 |
| InChI | InChI=1S/C7H4BN3O2/c8-3-1-4(7(12)13)6-5(2-3)9-11-10-6/h1-2H,(H,12,13)(H,9,10,11) |
| InChIKey | MAOYMYURJVSYIJ-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.94 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 164564366 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164564366?
The IUPAC name of CID 164564366 (CID 164564366) is not available.
What is the SMILES notation for CID 164564366?
The canonical SMILES for CID 164564366 is [B]c1cc(C(=O)O)c2n[nH]nc2c1.
What is the InChIKey of CID 164564366?
The InChIKey is MAOYMYURJVSYIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BN3O2/c8-3-1-4(7(12)13)6-5(2-3)9-11-10-6/h1-2H,(H,12,13)(H,9,10,11).
What are the key properties of CID 164564366?
CID 164564366 has a molecular weight of 172.94 g/mol, XLogP of -0.55, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164564366 is sourced from PubChem (CID 164564366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).