C27H35FN5O5- — CID 164565004
N-(2-amino-4-fluorophenyl)-7-[4-[4-[(2R,4S,6S)-4-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-1,2-diaza-3-azanidacyclopent-4-en-1-yl]heptanamide (PubChem CID 164565004) has the molecular formula C27H35FN5O5- and a molecular weight of 528.61 g/mol. Its IUPAC name is N-(2-amino-4-fluorophenyl)-7-[4-[4-[(2R,4S,6S)-4-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-1,2-diaza-3-azanidacyclopent-4-en-1-yl]heptanamide.
| Compound Name | N-(2-amino-4-fluorophenyl)-7-[4-[4-[(2R,4S,6S)-4-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-1,2-diaza-3-azanidacyclopent-4-en-1-yl]heptanamide |
|---|---|
| PubChem CID | 164565004 |
| Molecular Formula | C27H35FN5O5- |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | N-(2-amino-4-fluorophenyl)-7-[4-[4-[(2R,4S,6S)-4-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-1,2-diaza-3-azanidacyclopent-4-en-1-yl]heptanamide |
| SMILES | Nc1cc(F)ccc1NC(=O)CCCCCCN1C=C(c2ccc(O[C@@H]3C[C@@H](O)C[C@@H](CO)O3)cc2)[N-]N1 |
| InChI | InChI=1S/C27H35FN5O5/c28-19-8-11-24(23(29)13-19)30-26(36)5-3-1-2-4-12-33-16-25(31-32-33)18-6-9-21(10-7-18)37-27-15-20(35)14-22(17-34)38-27/h6-11,13,16,20,22,27,32,34-35H,1-5,12,14-15,17,29H2,(H,30,36)/q-1/t20-,22-,27-/m0/s1 |
| InChIKey | IYYMESMYKRPGTG-CLHVYKLBSA-N |
| XLogP | 3.64 |
| TPSA | 143.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|