C10H14N2O4S — CID 164566528
(5-tert-butyl-2-pyridinyl)sulfonylcarbamic acid (PubChem CID 164566528) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is (5-tert-butyl-2-pyridinyl)sulfonylcarbamic acid.
| Compound Name | (5-tert-butyl-2-pyridinyl)sulfonylcarbamic acid |
|---|---|
| PubChem CID | 164566528 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | (5-tert-butyl-2-pyridinyl)sulfonylcarbamic acid |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)NC(=O)O)nc1 |
| InChI | InChI=1S/C10H14N2O4S/c1-10(2,3)7-4-5-8(11-6-7)17(15,16)12-9(13)14/h4-6,12H,1-3H3,(H,13,14) |
| InChIKey | CTHDKAXOTZUJHD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |