C21H23BrINO2 — CID 164566869
N-(4-bromo-2-iodophenyl)-4-(phenylmethoxymethyl)cyclohexane-1-carboxamide (PubChem CID 164566869) has the molecular formula C21H23BrINO2 and a molecular weight of 528.23 g/mol. Its IUPAC name is N-(4-bromo-2-iodophenyl)-4-(phenylmethoxymethyl)cyclohexane-1-carboxamide.
| Compound Name | N-(4-bromo-2-iodophenyl)-4-(phenylmethoxymethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 164566869 |
| Molecular Formula | C21H23BrINO2 |
| Molecular Weight | 528.23 g/mol |
| Exact Mass | 527.00 |
| IUPAC Name | N-(4-bromo-2-iodophenyl)-4-(phenylmethoxymethyl)cyclohexane-1-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1I)C1CCC(COCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H23BrINO2/c22-18-10-11-20(19(23)12-18)24-21(25)17-8-6-16(7-9-17)14-26-13-15-4-2-1-3-5-15/h1-5,10-12,16-17H,6-9,13-14H2,(H,24,25) |
| InChIKey | XVMDMNZDWVPDJP-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.23 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|