C23H33BrN2O2 — CID 164567064
N-(6-bromo-4-methyl-3-pyridinyl)cyclohexanecarboxamide;ethane;methoxymethylbenzene (PubChem CID 164567064) has the molecular formula C23H33BrN2O2 and a molecular weight of 449.43 g/mol. Its IUPAC name is N-(6-bromo-4-methyl-3-pyridinyl)cyclohexanecarboxamide;ethane;methoxymethylbenzene.
| Compound Name | N-(6-bromo-4-methyl-3-pyridinyl)cyclohexanecarboxamide;ethane;methoxymethylbenzene |
|---|---|
| PubChem CID | 164567064 |
| Molecular Formula | C23H33BrN2O2 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | N-(6-bromo-4-methyl-3-pyridinyl)cyclohexanecarboxamide;ethane;methoxymethylbenzene |
| SMILES | CC.COCc1ccccc1.Cc1cc(Br)ncc1NC(=O)C1CCCCC1 |
| InChI | InChI=1S/C13H17BrN2O.C8H10O.C2H6/c1-9-7-12(14)15-8-11(9)16-13(17)10-5-3-2-4-6-10;1-9-7-8-5-3-2-4-6-8;1-2/h7-8,10H,2-6H2,1H3,(H,16,17);2-6H,7H2,1H3;1-2H3 |
| InChIKey | CJOKYMPWPGFGKY-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|