C21H32N4O — CID 164567245
6-methoxy-5-methyl-2-[4-[(4-methylpiperazin-1-yl)methyl]cyclohexyl]indazole (PubChem CID 164567245) has the molecular formula C21H32N4O and a molecular weight of 356.51 g/mol. Its IUPAC name is 6-methoxy-5-methyl-2-[4-[(4-methylpiperazin-1-yl)methyl]cyclohexyl]indazole.
| Compound Name | 6-methoxy-5-methyl-2-[4-[(4-methylpiperazin-1-yl)methyl]cyclohexyl]indazole |
|---|---|
| PubChem CID | 164567245 |
| Molecular Formula | C21H32N4O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | 6-methoxy-5-methyl-2-[4-[(4-methylpiperazin-1-yl)methyl]cyclohexyl]indazole |
| SMILES | COc1cc2nn(C3CCC(CN4CCN(C)CC4)CC3)cc2cc1C |
| InChI | InChI=1S/C21H32N4O/c1-16-12-18-15-25(22-20(18)13-21(16)26-3)19-6-4-17(5-7-19)14-24-10-8-23(2)9-11-24/h12-13,15,17,19H,4-11,14H2,1-3H3 |
| InChIKey | ZJUNKFSZWJQUMA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |