C25H28IN5O3 — CID 164567866
N-[2-(4-iodocyclohexyl)-6-methoxyindazol-5-yl]-6-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]pyridine-2-carboxamide (PubChem CID 164567866) has the molecular formula C25H28IN5O3 and a molecular weight of 573.44 g/mol. Its IUPAC name is N-[2-(4-iodocyclohexyl)-6-methoxyindazol-5-yl]-6-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]pyridine-2-carboxamide.
| Compound Name | N-[2-(4-iodocyclohexyl)-6-methoxyindazol-5-yl]-6-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 164567866 |
| Molecular Formula | C25H28IN5O3 |
| Molecular Weight | 573.44 g/mol |
| Exact Mass | 573.12 |
| IUPAC Name | N-[2-(4-iodocyclohexyl)-6-methoxyindazol-5-yl]-6-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]pyridine-2-carboxamide |
| SMILES | COc1cc2nn(C3CCC(I)CC3)cc2cc1NC(=O)c1cccc(N2C[C@@H]3C[C@H]2CO3)n1 |
| InChI | InChI=1S/C25H28IN5O3/c1-33-23-11-21-15(12-31(29-21)17-7-5-16(26)6-8-17)9-22(23)28-25(32)20-3-2-4-24(27-20)30-13-19-10-18(30)14-34-19/h2-4,9,11-12,16-19H,5-8,10,13-14H2,1H3,(H,28,32)/t16?,17?,18-,19-/m0/s1 |
| InChIKey | UKIDTDUNHNWYFP-BTRQGYIVSA-N |
| XLogP | 4.59 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|