C24H27N5O2 — CID 167375733
6-isocyano-N-[6-methoxy-2-(4-propan-2-ylcyclohexyl)indazol-5-yl]pyridine-2-carboxamide (PubChem CID 167375733) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 6-isocyano-N-[6-methoxy-2-(4-propan-2-ylcyclohexyl)indazol-5-yl]pyridine-2-carboxamide.
| Compound Name | 6-isocyano-N-[6-methoxy-2-(4-propan-2-ylcyclohexyl)indazol-5-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 167375733 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 6-isocyano-N-[6-methoxy-2-(4-propan-2-ylcyclohexyl)indazol-5-yl]pyridine-2-carboxamide |
| SMILES | [C-]#[N+]c1cccc(C(=O)Nc2cc3cn(C4CCC(C(C)C)CC4)nc3cc2OC)n1 |
| InChI | InChI=1S/C24H27N5O2/c1-15(2)16-8-10-18(11-9-16)29-14-17-12-21(22(31-4)13-20(17)28-29)27-24(30)19-6-5-7-23(25-3)26-19/h5-7,12-16,18H,8-11H2,1-2,4H3,(H,27,30) |
| InChIKey | ZTXGVRMSVNWJFV-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|