C26H29IN6O2 — CID 155449126
N-[2-[4-(1-iodoethyl)cyclohexyl]-6-methoxyindazol-5-yl]-6-(1-methylpyrazol-4-yl)pyridine-2-carboxamide (PubChem CID 155449126) has the molecular formula C26H29IN6O2 and a molecular weight of 584.46 g/mol. Its IUPAC name is N-[2-[4-(1-iodoethyl)cyclohexyl]-6-methoxyindazol-5-yl]-6-(1-methylpyrazol-4-yl)pyridine-2-carboxamide.
| Compound Name | N-[2-[4-(1-iodoethyl)cyclohexyl]-6-methoxyindazol-5-yl]-6-(1-methylpyrazol-4-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155449126 |
| Molecular Formula | C26H29IN6O2 |
| Molecular Weight | 584.46 g/mol |
| Exact Mass | 584.14 |
| IUPAC Name | N-[2-[4-(1-iodoethyl)cyclohexyl]-6-methoxyindazol-5-yl]-6-(1-methylpyrazol-4-yl)pyridine-2-carboxamide |
| SMILES | COc1cc2nn(C3CCC(C(C)I)CC3)cc2cc1NC(=O)c1cccc(-c2cnn(C)c2)n1 |
| InChI | InChI=1S/C26H29IN6O2/c1-16(27)17-7-9-20(10-8-17)33-15-18-11-24(25(35-3)12-23(18)31-33)30-26(34)22-6-4-5-21(29-22)19-13-28-32(2)14-19/h4-6,11-17,20H,7-10H2,1-3H3,(H,30,34) |
| InChIKey | VNEUYVYJNUWHRN-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.46 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|