C23H27IN4O3 — CID 167156200
N-[2-[4-(1-iodoethyl)cyclohexyl]-6-methoxyindazol-5-yl]-5-methoxypyridine-3-carboxamide (PubChem CID 167156200) has the molecular formula C23H27IN4O3 and a molecular weight of 534.40 g/mol. Its IUPAC name is N-[2-[4-(1-iodoethyl)cyclohexyl]-6-methoxyindazol-5-yl]-5-methoxypyridine-3-carboxamide.
| Compound Name | N-[2-[4-(1-iodoethyl)cyclohexyl]-6-methoxyindazol-5-yl]-5-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 167156200 |
| Molecular Formula | C23H27IN4O3 |
| Molecular Weight | 534.40 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | N-[2-[4-(1-iodoethyl)cyclohexyl]-6-methoxyindazol-5-yl]-5-methoxypyridine-3-carboxamide |
| SMILES | COc1cncc(C(=O)Nc2cc3cn(C4CCC(C(C)I)CC4)nc3cc2OC)c1 |
| InChI | InChI=1S/C23H27IN4O3/c1-14(24)15-4-6-18(7-5-15)28-13-17-9-21(22(31-3)10-20(17)27-28)26-23(29)16-8-19(30-2)12-25-11-16/h8-15,18H,4-7H2,1-3H3,(H,26,29) |
| InChIKey | WPQBDTJBSUGJOF-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.40 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|