C23H25ClIN3O2 — CID 155449238
4-chloro-N-[2-[4-(1-iodoethyl)cyclohexyl]-6-methoxyindazol-5-yl]benzamide (PubChem CID 155449238) has the molecular formula C23H25ClIN3O2 and a molecular weight of 537.83 g/mol. Its IUPAC name is 4-chloro-N-[2-[4-(1-iodoethyl)cyclohexyl]-6-methoxyindazol-5-yl]benzamide.
| Compound Name | 4-chloro-N-[2-[4-(1-iodoethyl)cyclohexyl]-6-methoxyindazol-5-yl]benzamide |
|---|---|
| PubChem CID | 155449238 |
| Molecular Formula | C23H25ClIN3O2 |
| Molecular Weight | 537.83 g/mol |
| Exact Mass | 537.07 |
| IUPAC Name | 4-chloro-N-[2-[4-(1-iodoethyl)cyclohexyl]-6-methoxyindazol-5-yl]benzamide |
| SMILES | COc1cc2nn(C3CCC(C(C)I)CC3)cc2cc1NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H25ClIN3O2/c1-14(25)15-5-9-19(10-6-15)28-13-17-11-21(22(30-2)12-20(17)27-28)26-23(29)16-3-7-18(24)8-4-16/h3-4,7-8,11-15,19H,5-6,9-10H2,1-2H3,(H,26,29) |
| InChIKey | NOZAFGMNRBQMLL-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.83 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|