C23H24F3N3O2 — CID 170240298
N-[6-methoxy-2-(4-methylcyclohexyl)indazol-5-yl]-4-(trifluoromethyl)benzamide (PubChem CID 170240298) has the molecular formula C23H24F3N3O2 and a molecular weight of 431.46 g/mol. Its IUPAC name is N-[6-methoxy-2-(4-methylcyclohexyl)indazol-5-yl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[6-methoxy-2-(4-methylcyclohexyl)indazol-5-yl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 170240298 |
| Molecular Formula | C23H24F3N3O2 |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | N-[6-methoxy-2-(4-methylcyclohexyl)indazol-5-yl]-4-(trifluoromethyl)benzamide |
| SMILES | COc1cc2nn(C3CCC(C)CC3)cc2cc1NC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H24F3N3O2/c1-14-3-9-18(10-4-14)29-13-16-11-20(21(31-2)12-19(16)28-29)27-22(30)15-5-7-17(8-6-15)23(24,25)26/h5-8,11-14,18H,3-4,9-10H2,1-2H3,(H,27,30) |
| InChIKey | SGULLOJHNLMMPD-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |