About CID 164568231
CID 164568231 (PubChem CID 164568231) has the molecular formula C6H2BClFNO2
and a molecular weight of 185.35 g/mol.
Molecular Properties
| Compound Name | CID 164568231 |
| PubChem CID | 164568231 |
| Molecular Formula | C6H2BClFNO2 |
| Molecular Weight | 185.35 g/mol |
| Exact Mass | 184.99 |
| IUPAC Name | — |
| SMILES | [B]c1ccc([N+](=O)[O-])c(F)c1Cl |
| InChI | InChI=1S/C6H2BClFNO2/c7-3-1-2-4(10(11)12)6(9)5(3)8/h1-2H |
| InChIKey | RSVDFUCXIUAHDP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 164568231 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164568231?
The IUPAC name of CID 164568231 (CID 164568231) is not available.
What is the SMILES notation for CID 164568231?
The canonical SMILES for CID 164568231 is [B]c1ccc([N+](=O)[O-])c(F)c1Cl.
What is the InChIKey of CID 164568231?
The InChIKey is RSVDFUCXIUAHDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2BClFNO2/c7-3-1-2-4(10(11)12)6(9)5(3)8/h1-2H.
What are the key properties of CID 164568231?
CID 164568231 has a molecular weight of 185.35 g/mol, XLogP of 1.18, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164568231 is sourced from PubChem (CID 164568231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).