C20H23N5O — CID 164574057
1-methyl-3-[5-(2-piperidin-1-yl-4-pyridinyl)-1H-indol-3-yl]urea (PubChem CID 164574057) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is 1-methyl-3-[5-(2-piperidin-1-yl-4-pyridinyl)-1H-indol-3-yl]urea.
| Compound Name | 1-methyl-3-[5-(2-piperidin-1-yl-4-pyridinyl)-1H-indol-3-yl]urea |
|---|---|
| PubChem CID | 164574057 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 1-methyl-3-[5-(2-piperidin-1-yl-4-pyridinyl)-1H-indol-3-yl]urea |
| SMILES | CNC(=O)Nc1c[nH]c2ccc(-c3ccnc(N4CCCCC4)c3)cc12 |
| InChI | InChI=1S/C20H23N5O/c1-21-20(26)24-18-13-23-17-6-5-14(11-16(17)18)15-7-8-22-19(12-15)25-9-3-2-4-10-25/h5-8,11-13,23H,2-4,9-10H2,1H3,(H2,21,24,26) |
| InChIKey | GLQSGDDQBVLUOD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |