C27H24ClF2N9O — CID 164574572
3-[(1R)-1-[[6-[2-(5-azidopentoxy)pyrimidin-5-yl]-3-chloro-7-fluoro-2-methyl-1,5-naphthyridin-4-yl]amino]ethyl]-4-fluorobenzonitrile (PubChem CID 164574572) has the molecular formula C27H24ClF2N9O and a molecular weight of 564.00 g/mol. Its IUPAC name is 3-[(1R)-1-[[6-[2-(5-azidopentoxy)pyrimidin-5-yl]-3-chloro-7-fluoro-2-methyl-1,5-naphthyridin-4-yl]amino]ethyl]-4-fluorobenzonitrile.
| Compound Name | 3-[(1R)-1-[[6-[2-(5-azidopentoxy)pyrimidin-5-yl]-3-chloro-7-fluoro-2-methyl-1,5-naphthyridin-4-yl]amino]ethyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 164574572 |
| Molecular Formula | C27H24ClF2N9O |
| Molecular Weight | 564.00 g/mol |
| Exact Mass | 563.18 |
| IUPAC Name | 3-[(1R)-1-[[6-[2-(5-azidopentoxy)pyrimidin-5-yl]-3-chloro-7-fluoro-2-methyl-1,5-naphthyridin-4-yl]amino]ethyl]-4-fluorobenzonitrile |
| SMILES | Cc1nc2cc(F)c(-c3cnc(OCCCCCN=[N+]=[N-])nc3)nc2c(N[C@H](C)c2cc(C#N)ccc2F)c1Cl |
| InChI | InChI=1S/C27H24ClF2N9O/c1-15(19-10-17(12-31)6-7-20(19)29)37-26-23(28)16(2)36-22-11-21(30)24(38-25(22)26)18-13-33-27(34-14-18)40-9-5-3-4-8-35-39-32/h6-7,10-11,13-15H,3-5,8-9H2,1-2H3,(H,36,37)/t15-/m1/s1 |
| InChIKey | IHRSOUOWGKIYLQ-OAHLLOKOSA-N |
| XLogP | 7.23 |
| TPSA | 145.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.00 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|