C29H26ClF2N11O — CID 175985628
3-[(1R)-1-[[6-[2-[(3R)-4-(2-azidoacetyl)-3-methylpiperazin-1-yl]pyrimidin-5-yl]-3-chloro-7-fluoro-2-methyl-1,5-naphthyridin-4-yl]amino]ethyl]-4-fluorobenzonitrile (PubChem CID 175985628) has the molecular formula C29H26ClF2N11O and a molecular weight of 618.05 g/mol. Its IUPAC name is 3-[(1R)-1-[[6-[2-[(3R)-4-(2-azidoacetyl)-3-methylpiperazin-1-yl]pyrimidin-5-yl]-3-chloro-7-fluoro-2-methyl-1,5-naphthyridin-4-yl]amino]ethyl]-4-fluorobenzonitrile.
| Compound Name | 3-[(1R)-1-[[6-[2-[(3R)-4-(2-azidoacetyl)-3-methylpiperazin-1-yl]pyrimidin-5-yl]-3-chloro-7-fluoro-2-methyl-1,5-naphthyridin-4-yl]amino]ethyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 175985628 |
| Molecular Formula | C29H26ClF2N11O |
| Molecular Weight | 618.05 g/mol |
| Exact Mass | 617.20 |
| IUPAC Name | 3-[(1R)-1-[[6-[2-[(3R)-4-(2-azidoacetyl)-3-methylpiperazin-1-yl]pyrimidin-5-yl]-3-chloro-7-fluoro-2-methyl-1,5-naphthyridin-4-yl]amino]ethyl]-4-fluorobenzonitrile |
| SMILES | Cc1nc2cc(F)c(-c3cnc(N4CCN(C(=O)CN=[N+]=[N-])[C@H](C)C4)nc3)nc2c(N[C@H](C)c2cc(C#N)ccc2F)c1Cl |
| InChI | InChI=1S/C29H26ClF2N11O/c1-15-14-42(6-7-43(15)24(44)13-37-41-34)29-35-11-19(12-36-29)26-22(32)9-23-27(40-26)28(25(30)17(3)38-23)39-16(2)20-8-18(10-33)4-5-21(20)31/h4-5,8-9,11-12,15-16H,6-7,13-14H2,1-3H3,(H,38,39)/t15-,16-/m1/s1 |
| InChIKey | FNWYFLZVIGYUAU-HZPDHXFCSA-N |
| XLogP | 5.72 |
| TPSA | 159.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.05 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|