C13H16N8O — CID 164576231
(3-aminopyrazin-2-yl)-[4-(6-aminopyrimidin-4-yl)piperazin-1-yl]methanone (PubChem CID 164576231) has the molecular formula C13H16N8O and a molecular weight of 300.33 g/mol. Its IUPAC name is (3-aminopyrazin-2-yl)-[4-(6-aminopyrimidin-4-yl)piperazin-1-yl]methanone.
| Compound Name | (3-aminopyrazin-2-yl)-[4-(6-aminopyrimidin-4-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 164576231 |
| Molecular Formula | C13H16N8O |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (3-aminopyrazin-2-yl)-[4-(6-aminopyrimidin-4-yl)piperazin-1-yl]methanone |
| SMILES | Nc1cc(N2CCN(C(=O)c3nccnc3N)CC2)ncn1 |
| InChI | InChI=1S/C13H16N8O/c14-9-7-10(19-8-18-9)20-3-5-21(6-4-20)13(22)11-12(15)17-2-1-16-11/h1-2,7-8H,3-6H2,(H2,15,17)(H2,14,18,19) |
| InChIKey | LOOQLEOHCDFZBJ-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 127.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |