C42H54N12 — CID 164577068
3,5-dimethyl-1-[[2,3,4,5,6-pentakis[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]methyl]pyrazole (PubChem CID 164577068) has the molecular formula C42H54N12 and a molecular weight of 726.98 g/mol. Its IUPAC name is 3,5-dimethyl-1-[[2,3,4,5,6-pentakis[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]methyl]pyrazole.
| Compound Name | 3,5-dimethyl-1-[[2,3,4,5,6-pentakis[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]methyl]pyrazole |
|---|---|
| PubChem CID | 164577068 |
| Molecular Formula | C42H54N12 |
| Molecular Weight | 726.98 g/mol |
| Exact Mass | 726.46 |
| IUPAC Name | 3,5-dimethyl-1-[[2,3,4,5,6-pentakis[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]methyl]pyrazole |
| SMILES | Cc1cc(C)n(Cc2c(Cn3nc(C)cc3C)c(Cn3nc(C)cc3C)c(Cn3nc(C)cc3C)c(Cn3nc(C)cc3C)c2Cn2nc(C)cc2C)n1 |
| InChI | InChI=1S/C42H54N12/c1-25-13-31(7)49(43-25)19-37-38(20-50-32(8)14-26(2)44-50)40(22-52-34(10)16-28(4)46-52)42(24-54-36(12)18-30(6)48-54)41(23-53-35(11)17-29(5)47-53)39(37)21-51-33(9)15-27(3)45-51/h13-18H,19-24H2,1-12H3 |
| InChIKey | QNTWUJVYUWJQNY-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 106.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.98 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |