C25H24FNO2 — CID 164579285
(2R,3S)-N-benzyl-2-(3-fluorophenyl)-3-phenylmethoxypent-4-enamide (PubChem CID 164579285) has the molecular formula C25H24FNO2 and a molecular weight of 389.47 g/mol. Its IUPAC name is (2R,3S)-N-benzyl-2-(3-fluorophenyl)-3-phenylmethoxypent-4-enamide.
| Compound Name | (2R,3S)-N-benzyl-2-(3-fluorophenyl)-3-phenylmethoxypent-4-enamide |
|---|---|
| PubChem CID | 164579285 |
| Molecular Formula | C25H24FNO2 |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | (2R,3S)-N-benzyl-2-(3-fluorophenyl)-3-phenylmethoxypent-4-enamide |
| SMILES | C=C[C@H](OCc1ccccc1)[C@H](C(=O)NCc1ccccc1)c1cccc(F)c1 |
| InChI | InChI=1S/C25H24FNO2/c1-2-23(29-18-20-12-7-4-8-13-20)24(21-14-9-15-22(26)16-21)25(28)27-17-19-10-5-3-6-11-19/h2-16,23-24H,1,17-18H2,(H,27,28)/t23-,24+/m0/s1 |
| InChIKey | GATXQJPHYFPZAD-BJKOFHAPSA-N |
| XLogP | 5.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|