C25H25NO2 — CID 164579287
(2R,3S)-N-benzyl-2-phenyl-3-phenylmethoxypent-4-enamide (PubChem CID 164579287) has the molecular formula C25H25NO2 and a molecular weight of 371.48 g/mol. Its IUPAC name is (2R,3S)-N-benzyl-2-phenyl-3-phenylmethoxypent-4-enamide.
| Compound Name | (2R,3S)-N-benzyl-2-phenyl-3-phenylmethoxypent-4-enamide |
|---|---|
| PubChem CID | 164579287 |
| Molecular Formula | C25H25NO2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | (2R,3S)-N-benzyl-2-phenyl-3-phenylmethoxypent-4-enamide |
| SMILES | C=C[C@H](OCc1ccccc1)[C@H](C(=O)NCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H25NO2/c1-2-23(28-19-21-14-8-4-9-15-21)24(22-16-10-5-11-17-22)25(27)26-18-20-12-6-3-7-13-20/h2-17,23-24H,1,18-19H2,(H,26,27)/t23-,24+/m0/s1 |
| InChIKey | UVUUOVFXUXIJFA-BJKOFHAPSA-N |
| XLogP | 4.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|