About 2-deuterio-2,3,3a,4-tetrahydrothieno[3,2-b]pyridine
2-deuterio-2,3,3a,4-tetrahydrothieno[3,2-b]pyridine (PubChem CID 164579808) has the molecular formula C7H9NS
and a molecular weight of 140.23 g/mol. Its IUPAC name is 2-deuterio-2,3,3a,4-tetrahydrothieno[3,2-b]pyridine.
Analyze 2-deuterio-2,3,3a,4-tetrahydrothieno[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-deuterio-2,3,3a,4-tetrahydrothieno[3,2-b]pyridine?
The IUPAC name of 2-deuterio-2,3,3a,4-tetrahydrothieno[3,2-b]pyridine (CID 164579808) is 2-deuterio-2,3,3a,4-tetrahydrothieno[3,2-b]pyridine.
What is the SMILES notation for 2-deuterio-2,3,3a,4-tetrahydrothieno[3,2-b]pyridine?
The canonical SMILES for 2-deuterio-2,3,3a,4-tetrahydrothieno[3,2-b]pyridine is [2H]C1CC2NC=CC=C2S1.
What is the InChIKey of 2-deuterio-2,3,3a,4-tetrahydrothieno[3,2-b]pyridine?
The InChIKey is WJFYLCXWEXZNHU-UICOGKGYSA-N. The full InChI is InChI=1S/C7H9NS/c1-2-7-6(8-4-1)3-5-9-7/h1-2,4,6,8H,3,5H2/i5D.
What are the key properties of 2-deuterio-2,3,3a,4-tetrahydrothieno[3,2-b]pyridine?
2-deuterio-2,3,3a,4-tetrahydrothieno[3,2-b]pyridine has a molecular weight of 140.23 g/mol, XLogP of 1.49, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-deuterio-2,3,3a,4-tetrahydrothieno[3,2-b]pyridine is sourced from PubChem (CID 164579808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).