C12H15F3N2O3 — CID 164584047
butyl N-[6-(2,2,2-trifluoro-1-hydroxyethyl)-3-pyridinyl]carbamate (PubChem CID 164584047) has the molecular formula C12H15F3N2O3 and a molecular weight of 292.26 g/mol. Its IUPAC name is butyl N-[6-(2,2,2-trifluoro-1-hydroxyethyl)-3-pyridinyl]carbamate.
| Compound Name | butyl N-[6-(2,2,2-trifluoro-1-hydroxyethyl)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 164584047 |
| Molecular Formula | C12H15F3N2O3 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | butyl N-[6-(2,2,2-trifluoro-1-hydroxyethyl)-3-pyridinyl]carbamate |
| SMILES | CCCCOC(=O)Nc1ccc(C(O)C(F)(F)F)nc1 |
| InChI | InChI=1S/C12H15F3N2O3/c1-2-3-6-20-11(19)17-8-4-5-9(16-7-8)10(18)12(13,14)15/h4-5,7,10,18H,2-3,6H2,1H3,(H,17,19) |
| InChIKey | QKFJEAVFABPDBQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|