C19H30N4O3 — CID 89487575
[1-[6-(hydroxymethyl)-3-pyridinyl]piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate (PubChem CID 89487575) has the molecular formula C19H30N4O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is [1-[6-(hydroxymethyl)-3-pyridinyl]piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate.
| Compound Name | [1-[6-(hydroxymethyl)-3-pyridinyl]piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 89487575 |
| Molecular Formula | C19H30N4O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | [1-[6-(hydroxymethyl)-3-pyridinyl]piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate |
| SMILES | CC(C)N1CCN(C(=O)OC2CCN(c3ccc(CO)nc3)CC2)CC1 |
| InChI | InChI=1S/C19H30N4O3/c1-15(2)21-9-11-23(12-10-21)19(25)26-18-5-7-22(8-6-18)17-4-3-16(14-24)20-13-17/h3-4,13,15,18,24H,5-12,14H2,1-2H3 |
| InChIKey | BUOHZOFCBOCKEZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |