C31H38N8O6 — CID 164587869
7-[3-[3-(2,5-dioxopyrrol-1-yl)propanoyl-methylamino]propoxy]-2-[(1-ethyl-5-methylpyrazole-3-carbonyl)amino]-1-[(E)-pent-2-enyl]benzimidazole-5-carboxamide (PubChem CID 164587869) has the molecular formula C31H38N8O6 and a molecular weight of 618.70 g/mol. Its IUPAC name is 7-[3-[3-(2,5-dioxopyrrol-1-yl)propanoyl-methylamino]propoxy]-2-[(1-ethyl-5-methylpyrazole-3-carbonyl)amino]-1-[(E)-pent-2-enyl]benzimidazole-5-carboxamide.
| Compound Name | 7-[3-[3-(2,5-dioxopyrrol-1-yl)propanoyl-methylamino]propoxy]-2-[(1-ethyl-5-methylpyrazole-3-carbonyl)amino]-1-[(E)-pent-2-enyl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 164587869 |
| Molecular Formula | C31H38N8O6 |
| Molecular Weight | 618.70 g/mol |
| Exact Mass | 618.29 |
| IUPAC Name | 7-[3-[3-(2,5-dioxopyrrol-1-yl)propanoyl-methylamino]propoxy]-2-[(1-ethyl-5-methylpyrazole-3-carbonyl)amino]-1-[(E)-pent-2-enyl]benzimidazole-5-carboxamide |
| SMILES | CC/C=C/Cn1c(NC(=O)c2cc(C)n(CC)n2)nc2cc(C(N)=O)cc(OCCCN(C)C(=O)CCN3C(=O)C=CC3=O)c21 |
| InChI | InChI=1S/C31H38N8O6/c1-5-7-8-14-38-28-22(33-31(38)34-30(44)23-17-20(3)39(6-2)35-23)18-21(29(32)43)19-24(28)45-16-9-13-36(4)25(40)12-15-37-26(41)10-11-27(37)42/h7-8,10-11,17-19H,5-6,9,12-16H2,1-4H3,(H2,32,43)(H,33,34,44)/b8-7+ |
| InChIKey | VIDLJDPUHBPMJW-BQYQJAHWSA-N |
| XLogP | 2.42 |
| TPSA | 174.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.70 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|