C7H5F3N2O — CID 164588804
N-(2,5,6-trifluoro-3-pyridinyl)acetamide (PubChem CID 164588804) has the molecular formula C7H5F3N2O and a molecular weight of 190.12 g/mol. Its IUPAC name is N-(2,5,6-trifluoro-3-pyridinyl)acetamide.
| Compound Name | N-(2,5,6-trifluoro-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 164588804 |
| Molecular Formula | C7H5F3N2O |
| Molecular Weight | 190.12 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | N-(2,5,6-trifluoro-3-pyridinyl)acetamide |
| SMILES | CC(=O)Nc1cc(F)c(F)nc1F |
| InChI | InChI=1S/C7H5F3N2O/c1-3(13)11-5-2-4(8)6(9)12-7(5)10/h2H,1H3,(H,11,13) |
| InChIKey | BQIPNCPSIAALOC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.12 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|