C13H20ClF2N — CID 164589400
chloromethane;(1R)-1-[3-(1,1-difluoro-2-methylpropyl)phenyl]ethanamine (PubChem CID 164589400) has the molecular formula C13H20ClF2N and a molecular weight of 263.76 g/mol. Its IUPAC name is chloromethane;(1R)-1-[3-(1,1-difluoro-2-methylpropyl)phenyl]ethanamine.
| Compound Name | chloromethane;(1R)-1-[3-(1,1-difluoro-2-methylpropyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 164589400 |
| Molecular Formula | C13H20ClF2N |
| Molecular Weight | 263.76 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | chloromethane;(1R)-1-[3-(1,1-difluoro-2-methylpropyl)phenyl]ethanamine |
| SMILES | CC(C)C(F)(F)c1cccc([C@@H](C)N)c1.CCl |
| InChI | InChI=1S/C12H17F2N.CH3Cl/c1-8(2)12(13,14)11-6-4-5-10(7-11)9(3)15;1-2/h4-9H,15H2,1-3H3;1H3/t9-;/m1./s1 |
| InChIKey | KEOKJVBPSZKYSW-SBSPUUFOSA-N |
| XLogP | 4.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.76 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|