C11H13F2NO2 — CID 175863162
[2-[3-[(1R)-1-aminoethyl]phenyl]-2,2-difluoroethyl] formate (PubChem CID 175863162) has the molecular formula C11H13F2NO2 and a molecular weight of 229.23 g/mol. Its IUPAC name is [2-[3-[(1R)-1-aminoethyl]phenyl]-2,2-difluoroethyl] formate.
| Compound Name | [2-[3-[(1R)-1-aminoethyl]phenyl]-2,2-difluoroethyl] formate |
|---|---|
| PubChem CID | 175863162 |
| Molecular Formula | C11H13F2NO2 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | [2-[3-[(1R)-1-aminoethyl]phenyl]-2,2-difluoroethyl] formate |
| SMILES | C[C@@H](N)c1cccc(C(F)(F)COC=O)c1 |
| InChI | InChI=1S/C11H13F2NO2/c1-8(14)9-3-2-4-10(5-9)11(12,13)6-16-7-15/h2-5,7-8H,6,14H2,1H3/t8-/m1/s1 |
| InChIKey | HWRKONIRFZOXQL-MRVPVSSYSA-N |
| XLogP | 1.97 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|