C27H30N4O2 — CID 164589655
3-[[(1E,3Z)-1,4-diamino-4-phenylbuta-1,3-dienyl]amino]-N-[(4-propoxyphenyl)methyl]benzamide (PubChem CID 164589655) has the molecular formula C27H30N4O2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 3-[[(1E,3Z)-1,4-diamino-4-phenylbuta-1,3-dienyl]amino]-N-[(4-propoxyphenyl)methyl]benzamide.
| Compound Name | 3-[[(1E,3Z)-1,4-diamino-4-phenylbuta-1,3-dienyl]amino]-N-[(4-propoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 164589655 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 3-[[(1E,3Z)-1,4-diamino-4-phenylbuta-1,3-dienyl]amino]-N-[(4-propoxyphenyl)methyl]benzamide |
| SMILES | CCCOc1ccc(CNC(=O)c2cccc(N/C(N)=C/C=C(\N)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C27H30N4O2/c1-2-17-33-24-13-11-20(12-14-24)19-30-27(32)22-9-6-10-23(18-22)31-26(29)16-15-25(28)21-7-4-3-5-8-21/h3-16,18,31H,2,17,19,28-29H2,1H3,(H,30,32)/b25-15-,26-16+ |
| InChIKey | HIFNDHGRHWBZEH-WFOJNGAISA-N |
| XLogP | 4.62 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|