C25H27N3O3 — CID 39509628
N-[[4-(phenoxymethyl)phenyl]methyl]-3-(propan-2-ylcarbamoylamino)benzamide (PubChem CID 39509628) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-[[4-(phenoxymethyl)phenyl]methyl]-3-(propan-2-ylcarbamoylamino)benzamide.
| Compound Name | N-[[4-(phenoxymethyl)phenyl]methyl]-3-(propan-2-ylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 39509628 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | N-[[4-(phenoxymethyl)phenyl]methyl]-3-(propan-2-ylcarbamoylamino)benzamide |
| SMILES | CC(C)NC(=O)Nc1cccc(C(=O)NCc2ccc(COc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C25H27N3O3/c1-18(2)27-25(30)28-22-8-6-7-21(15-22)24(29)26-16-19-11-13-20(14-12-19)17-31-23-9-4-3-5-10-23/h3-15,18H,16-17H2,1-2H3,(H,26,29)(H2,27,28,30) |
| InChIKey | LJKIPGBAACNXMG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |