C20H23N3O5 — CID 119246830
2-[3-[[[4-(propan-2-ylcarbamoylamino)benzoyl]amino]methyl]phenoxy]acetic acid (PubChem CID 119246830) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is 2-[3-[[[4-(propan-2-ylcarbamoylamino)benzoyl]amino]methyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[[[4-(propan-2-ylcarbamoylamino)benzoyl]amino]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 119246830 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 2-[3-[[[4-(propan-2-ylcarbamoylamino)benzoyl]amino]methyl]phenoxy]acetic acid |
| SMILES | CC(C)NC(=O)Nc1ccc(C(=O)NCc2cccc(OCC(=O)O)c2)cc1 |
| InChI | InChI=1S/C20H23N3O5/c1-13(2)22-20(27)23-16-8-6-15(7-9-16)19(26)21-11-14-4-3-5-17(10-14)28-12-18(24)25/h3-10,13H,11-12H2,1-2H3,(H,21,26)(H,24,25)(H2,22,23,27) |
| InChIKey | KKBCDZXJSRMBMX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |