C21H17N5O — CID 164589837
N-(1-cyanocyclopropyl)-3-[(6-phenylpyridazin-3-yl)amino]benzamide (PubChem CID 164589837) has the molecular formula C21H17N5O and a molecular weight of 355.40 g/mol. Its IUPAC name is N-(1-cyanocyclopropyl)-3-[(6-phenylpyridazin-3-yl)amino]benzamide.
| Compound Name | N-(1-cyanocyclopropyl)-3-[(6-phenylpyridazin-3-yl)amino]benzamide |
|---|---|
| PubChem CID | 164589837 |
| Molecular Formula | C21H17N5O |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-(1-cyanocyclopropyl)-3-[(6-phenylpyridazin-3-yl)amino]benzamide |
| SMILES | N#CC1(NC(=O)c2cccc(Nc3ccc(-c4ccccc4)nn3)c2)CC1 |
| InChI | InChI=1S/C21H17N5O/c22-14-21(11-12-21)24-20(27)16-7-4-8-17(13-16)23-19-10-9-18(25-26-19)15-5-2-1-3-6-15/h1-10,13H,11-12H2,(H,23,26)(H,24,27) |
| InChIKey | WZDAZNAZHJCGHM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |