C23H34N2O4 — CID 164590149
tert-butyl (2S,7R)-2-benzyl-7-formyl-4-(3-methylbutyl)-3-oxo-1,4-diazepane-1-carboxylate (PubChem CID 164590149) has the molecular formula C23H34N2O4 and a molecular weight of 402.54 g/mol. Its IUPAC name is tert-butyl (2S,7R)-2-benzyl-7-formyl-4-(3-methylbutyl)-3-oxo-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl (2S,7R)-2-benzyl-7-formyl-4-(3-methylbutyl)-3-oxo-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 164590149 |
| Molecular Formula | C23H34N2O4 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | tert-butyl (2S,7R)-2-benzyl-7-formyl-4-(3-methylbutyl)-3-oxo-1,4-diazepane-1-carboxylate |
| SMILES | CC(C)CCN1CC[C@H](C=O)N(C(=O)OC(C)(C)C)[C@@H](Cc2ccccc2)C1=O |
| InChI | InChI=1S/C23H34N2O4/c1-17(2)11-13-24-14-12-19(16-26)25(22(28)29-23(3,4)5)20(21(24)27)15-18-9-7-6-8-10-18/h6-10,16-17,19-20H,11-15H2,1-5H3/t19-,20+/m1/s1 |
| InChIKey | VMJVDYCARJZLCZ-UXHICEINSA-N |
| XLogP | 3.68 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|