C49H86O9 — CID 164591025
1-O-[[3-(4,4-dioctoxybutanoyloxymethyl)-5-(hydroxymethyl)phenyl]methyl] 9-O-undecan-2-yl nonanedioate (PubChem CID 164591025) has the molecular formula C49H86O9 and a molecular weight of 819.22 g/mol. Its IUPAC name is 1-O-[[3-(4,4-dioctoxybutanoyloxymethyl)-5-(hydroxymethyl)phenyl]methyl] 9-O-undecan-2-yl nonanedioate.
| Compound Name | 1-O-[[3-(4,4-dioctoxybutanoyloxymethyl)-5-(hydroxymethyl)phenyl]methyl] 9-O-undecan-2-yl nonanedioate |
|---|---|
| PubChem CID | 164591025 |
| Molecular Formula | C49H86O9 |
| Molecular Weight | 819.22 g/mol |
| Exact Mass | 818.63 |
| IUPAC Name | 1-O-[[3-(4,4-dioctoxybutanoyloxymethyl)-5-(hydroxymethyl)phenyl]methyl] 9-O-undecan-2-yl nonanedioate |
| SMILES | CCCCCCCCCC(C)OC(=O)CCCCCCCC(=O)OCc1cc(CO)cc(COC(=O)CCC(OCCCCCCCC)OCCCCCCCC)c1 |
| InChI | InChI=1S/C49H86O9/c1-5-8-11-14-17-19-24-29-42(4)58-48(53)31-26-21-18-20-25-30-46(51)56-40-44-36-43(39-50)37-45(38-44)41-57-47(52)32-33-49(54-34-27-22-15-12-9-6-2)55-35-28-23-16-13-10-7-3/h36-38,42,49-50H,5-35,39-41H2,1-4H3 |
| InChIKey | UVBDDPBXMNLZQB-UHFFFAOYSA-N |
| XLogP | 12.93 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.22 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|