C38H68O5 — CID 174147219
[3-decyl-5-(hydroxymethyl)phenyl]methyl 4,4-dioctoxybutanoate (PubChem CID 174147219) has the molecular formula C38H68O5 and a molecular weight of 604.96 g/mol. Its IUPAC name is [3-decyl-5-(hydroxymethyl)phenyl]methyl 4,4-dioctoxybutanoate.
| Compound Name | [3-decyl-5-(hydroxymethyl)phenyl]methyl 4,4-dioctoxybutanoate |
|---|---|
| PubChem CID | 174147219 |
| Molecular Formula | C38H68O5 |
| Molecular Weight | 604.96 g/mol |
| Exact Mass | 604.51 |
| IUPAC Name | [3-decyl-5-(hydroxymethyl)phenyl]methyl 4,4-dioctoxybutanoate |
| SMILES | CCCCCCCCCCc1cc(CO)cc(COC(=O)CCC(OCCCCCCCC)OCCCCCCCC)c1 |
| InChI | InChI=1S/C38H68O5/c1-4-7-10-13-16-17-18-21-24-34-29-35(32-39)31-36(30-34)33-43-37(40)25-26-38(41-27-22-19-14-11-8-5-2)42-28-23-20-15-12-9-6-3/h29-31,38-39H,4-28,32-33H2,1-3H3 |
| InChIKey | PHKHZKNRNMYGCA-UHFFFAOYSA-N |
| XLogP | 10.77 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.96 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|