C33H49N3O6 — CID 164592602
4-[[5-[2-[3-[5-(3-ethylphenoxy)pentoxy]propoxy]ethylamino]-2-formylphenyl]methyl-methylamino]-N-formylpentanamide (PubChem CID 164592602) has the molecular formula C33H49N3O6 and a molecular weight of 583.77 g/mol. Its IUPAC name is 4-[[5-[2-[3-[5-(3-ethylphenoxy)pentoxy]propoxy]ethylamino]-2-formylphenyl]methyl-methylamino]-N-formylpentanamide.
| Compound Name | 4-[[5-[2-[3-[5-(3-ethylphenoxy)pentoxy]propoxy]ethylamino]-2-formylphenyl]methyl-methylamino]-N-formylpentanamide |
|---|---|
| PubChem CID | 164592602 |
| Molecular Formula | C33H49N3O6 |
| Molecular Weight | 583.77 g/mol |
| Exact Mass | 583.36 |
| IUPAC Name | 4-[[5-[2-[3-[5-(3-ethylphenoxy)pentoxy]propoxy]ethylamino]-2-formylphenyl]methyl-methylamino]-N-formylpentanamide |
| SMILES | CCc1cccc(OCCCCCOCCCOCCNc2ccc(C=O)c(CN(C)C(C)CCC(=O)NC=O)c2)c1 |
| InChI | InChI=1S/C33H49N3O6/c1-4-28-10-8-11-32(22-28)42-20-7-5-6-17-40-18-9-19-41-21-16-34-31-14-13-29(25-37)30(23-31)24-36(3)27(2)12-15-33(39)35-26-38/h8,10-11,13-14,22-23,25-27,34H,4-7,9,12,15-21,24H2,1-3H3,(H,35,38,39) |
| InChIKey | DMPWTLKZUJIEIA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.77 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|