C18H29NO6 — CID 2923948
N-[2-[2-(3-ethylphenoxy)ethoxy]ethyl]-2-methylpropan-2-amine;oxalic acid (PubChem CID 2923948) has the molecular formula C18H29NO6 and a molecular weight of 355.43 g/mol. Its IUPAC name is N-[2-[2-(3-ethylphenoxy)ethoxy]ethyl]-2-methylpropan-2-amine;oxalic acid.
| Compound Name | N-[2-[2-(3-ethylphenoxy)ethoxy]ethyl]-2-methylpropan-2-amine;oxalic acid |
|---|---|
| PubChem CID | 2923948 |
| Molecular Formula | C18H29NO6 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | N-[2-[2-(3-ethylphenoxy)ethoxy]ethyl]-2-methylpropan-2-amine;oxalic acid |
| SMILES | CCc1cccc(OCCOCCNC(C)(C)C)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H27NO2.C2H2O4/c1-5-14-7-6-8-15(13-14)19-12-11-18-10-9-17-16(2,3)4;3-1(4)2(5)6/h6-8,13,17H,5,9-12H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | UEMVQMXYIHXLNG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|