C22H21F2N3O — CID 164593563
5-[(3-amino-2,6-difluorophenyl)methoxy]-3-[(E)-1-phenylbut-1-enyl]pyridin-2-amine (PubChem CID 164593563) has the molecular formula C22H21F2N3O and a molecular weight of 381.43 g/mol. Its IUPAC name is 5-[(3-amino-2,6-difluorophenyl)methoxy]-3-[(E)-1-phenylbut-1-enyl]pyridin-2-amine.
| Compound Name | 5-[(3-amino-2,6-difluorophenyl)methoxy]-3-[(E)-1-phenylbut-1-enyl]pyridin-2-amine |
|---|---|
| PubChem CID | 164593563 |
| Molecular Formula | C22H21F2N3O |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 5-[(3-amino-2,6-difluorophenyl)methoxy]-3-[(E)-1-phenylbut-1-enyl]pyridin-2-amine |
| SMILES | CC/C=C(\c1ccccc1)c1cc(OCc2c(F)ccc(N)c2F)cnc1N |
| InChI | InChI=1S/C22H21F2N3O/c1-2-6-16(14-7-4-3-5-8-14)17-11-15(12-27-22(17)26)28-13-18-19(23)9-10-20(25)21(18)24/h3-12H,2,13,25H2,1H3,(H2,26,27)/b16-6+ |
| InChIKey | NRNHWNPDOLZXJL-OMCISZLKSA-N |
| XLogP | 4.94 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|