C21H34N2O3S — CID 164595655
tert-butyl N-(2-oxo-2-pyrrolidin-1-ylethyl)-N-[(5R)-5-sulfanyl-3-tricyclo[5.2.1.03,8]decanyl]carbamate (PubChem CID 164595655) has the molecular formula C21H34N2O3S and a molecular weight of 394.58 g/mol. Its IUPAC name is tert-butyl N-(2-oxo-2-pyrrolidin-1-ylethyl)-N-[(5R)-5-sulfanyl-3-tricyclo[5.2.1.03,8]decanyl]carbamate.
| Compound Name | tert-butyl N-(2-oxo-2-pyrrolidin-1-ylethyl)-N-[(5R)-5-sulfanyl-3-tricyclo[5.2.1.03,8]decanyl]carbamate |
|---|---|
| PubChem CID | 164595655 |
| Molecular Formula | C21H34N2O3S |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | tert-butyl N-(2-oxo-2-pyrrolidin-1-ylethyl)-N-[(5R)-5-sulfanyl-3-tricyclo[5.2.1.03,8]decanyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CC(=O)N1CCCC1)C12CC3CC(C[C@@H](S)C1)C2C3 |
| InChI | InChI=1S/C21H34N2O3S/c1-20(2,3)26-19(25)23(13-18(24)22-6-4-5-7-22)21-11-14-8-15(17(21)9-14)10-16(27)12-21/h14-17,27H,4-13H2,1-3H3/t14?,15?,16-,17?,21?/m1/s1 |
| InChIKey | ZYLLOOYULYDUGM-UPTRWORFSA-N |
| XLogP | 3.72 |
| TPSA | 49.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|