C20H37N3O3 — CID 69143161
tert-butyl N-ethyl-N-[2-[4-(1-methylpiperidin-4-yl)piperidin-1-yl]-2-oxoethyl]carbamate (PubChem CID 69143161) has the molecular formula C20H37N3O3 and a molecular weight of 367.53 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-[2-[4-(1-methylpiperidin-4-yl)piperidin-1-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-ethyl-N-[2-[4-(1-methylpiperidin-4-yl)piperidin-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 69143161 |
| Molecular Formula | C20H37N3O3 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.28 |
| IUPAC Name | tert-butyl N-ethyl-N-[2-[4-(1-methylpiperidin-4-yl)piperidin-1-yl]-2-oxoethyl]carbamate |
| SMILES | CCN(CC(=O)N1CCC(C2CCN(C)CC2)CC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H37N3O3/c1-6-22(19(25)26-20(2,3)4)15-18(24)23-13-9-17(10-14-23)16-7-11-21(5)12-8-16/h16-17H,6-15H2,1-5H3 |
| InChIKey | QEKWAMXQSQNWNT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |