C11H6N2O — CID 164596137
6H-furo[2,3-f]isoindole-5-carbonitrile (PubChem CID 164596137) has the molecular formula C11H6N2O and a molecular weight of 182.18 g/mol. Its IUPAC name is 6H-furo[2,3-f]isoindole-5-carbonitrile.
| Compound Name | 6H-furo[2,3-f]isoindole-5-carbonitrile |
|---|---|
| PubChem CID | 164596137 |
| Molecular Formula | C11H6N2O |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 6H-furo[2,3-f]isoindole-5-carbonitrile |
| SMILES | N#Cc1[nH]cc2cc3occc3cc12 |
| InChI | InChI=1S/C11H6N2O/c12-5-10-9-3-7-1-2-14-11(7)4-8(9)6-13-10/h1-4,6,13H |
| InChIKey | QPOFMJKUQOQIPU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 52.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |