C33H37N5O4 — CID 164596740
3-benzyl-8-[bis[(4-methoxyphenyl)methyl]amino]-6-butoxy-1,4-dihydropyrimido[5,4-d]pyrimidin-2-one (PubChem CID 164596740) has the molecular formula C33H37N5O4 and a molecular weight of 567.69 g/mol. Its IUPAC name is 3-benzyl-8-[bis[(4-methoxyphenyl)methyl]amino]-6-butoxy-1,4-dihydropyrimido[5,4-d]pyrimidin-2-one.
| Compound Name | 3-benzyl-8-[bis[(4-methoxyphenyl)methyl]amino]-6-butoxy-1,4-dihydropyrimido[5,4-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 164596740 |
| Molecular Formula | C33H37N5O4 |
| Molecular Weight | 567.69 g/mol |
| Exact Mass | 567.28 |
| IUPAC Name | 3-benzyl-8-[bis[(4-methoxyphenyl)methyl]amino]-6-butoxy-1,4-dihydropyrimido[5,4-d]pyrimidin-2-one |
| SMILES | CCCCOc1nc2c(c(N(Cc3ccc(OC)cc3)Cc3ccc(OC)cc3)n1)NC(=O)N(Cc1ccccc1)C2 |
| InChI | InChI=1S/C33H37N5O4/c1-4-5-19-42-32-34-29-23-38(22-24-9-7-6-8-10-24)33(39)35-30(29)31(36-32)37(20-25-11-15-27(40-2)16-12-25)21-26-13-17-28(41-3)18-14-26/h6-18H,4-5,19-23H2,1-3H3,(H,35,39) |
| InChIKey | WSOFTZDYQCFHMG-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.69 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|