C19H23ClN2O4 — CID 164596786
tert-butyl 3-(4-chloro-7-methoxyquinolin-6-yl)-3-methoxyazetidine-1-carboxylate (PubChem CID 164596786) has the molecular formula C19H23ClN2O4 and a molecular weight of 378.86 g/mol. Its IUPAC name is tert-butyl 3-(4-chloro-7-methoxyquinolin-6-yl)-3-methoxyazetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-chloro-7-methoxyquinolin-6-yl)-3-methoxyazetidine-1-carboxylate |
|---|---|
| PubChem CID | 164596786 |
| Molecular Formula | C19H23ClN2O4 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | tert-butyl 3-(4-chloro-7-methoxyquinolin-6-yl)-3-methoxyazetidine-1-carboxylate |
| SMILES | COc1cc2nccc(Cl)c2cc1C1(OC)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H23ClN2O4/c1-18(2,3)26-17(23)22-10-19(11-22,25-5)13-8-12-14(20)6-7-21-15(12)9-16(13)24-4/h6-9H,10-11H2,1-5H3 |
| InChIKey | YWRDTNIYFHKZPD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |