C15H24S — CID 164597145
3-[2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethyl]-2,5-dihydrothiophene (PubChem CID 164597145) has the molecular formula C15H24S and a molecular weight of 236.42 g/mol. Its IUPAC name is 3-[2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethyl]-2,5-dihydrothiophene.
| Compound Name | 3-[2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethyl]-2,5-dihydrothiophene |
|---|---|
| PubChem CID | 164597145 |
| Molecular Formula | C15H24S |
| Molecular Weight | 236.42 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 3-[2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethyl]-2,5-dihydrothiophene |
| SMILES | CC1=CCCC(C)(C)C1CCC1=CCSC1 |
| InChI | InChI=1S/C15H24S/c1-12-5-4-9-15(2,3)14(12)7-6-13-8-10-16-11-13/h5,8,14H,4,6-7,9-11H2,1-3H3 |
| InChIKey | BUTLHSYSAHASJJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|