C22H27F3O4S2 — CID 164597197
7-(8-ethenylsulfanyloxyoctylsulfanyl)-4-methyl-3-(trifluoromethoxymethyl)chromen-2-one (PubChem CID 164597197) has the molecular formula C22H27F3O4S2 and a molecular weight of 476.58 g/mol. Its IUPAC name is 7-(8-ethenylsulfanyloxyoctylsulfanyl)-4-methyl-3-(trifluoromethoxymethyl)chromen-2-one.
| Compound Name | 7-(8-ethenylsulfanyloxyoctylsulfanyl)-4-methyl-3-(trifluoromethoxymethyl)chromen-2-one |
|---|---|
| PubChem CID | 164597197 |
| Molecular Formula | C22H27F3O4S2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 7-(8-ethenylsulfanyloxyoctylsulfanyl)-4-methyl-3-(trifluoromethoxymethyl)chromen-2-one |
| SMILES | C=CSOCCCCCCCCSc1ccc2c(C)c(COC(F)(F)F)c(=O)oc2c1 |
| InChI | InChI=1S/C22H27F3O4S2/c1-3-31-28-12-8-6-4-5-7-9-13-30-17-10-11-18-16(2)19(15-27-22(23,24)25)21(26)29-20(18)14-17/h3,10-11,14H,1,4-9,12-13,15H2,2H3 |
| InChIKey | UCRKJVLVEZJWID-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|