C25H31FO5S2 — CID 164597221
7-(4-cyclohexyl-3-fluoro-1,1-dioxo-2-sulfanylidenethiochromen-6-yl)oxyheptyl prop-2-enoate (PubChem CID 164597221) has the molecular formula C25H31FO5S2 and a molecular weight of 494.65 g/mol. Its IUPAC name is 7-(4-cyclohexyl-3-fluoro-1,1-dioxo-2-sulfanylidenethiochromen-6-yl)oxyheptyl prop-2-enoate.
| Compound Name | 7-(4-cyclohexyl-3-fluoro-1,1-dioxo-2-sulfanylidenethiochromen-6-yl)oxyheptyl prop-2-enoate |
|---|---|
| PubChem CID | 164597221 |
| Molecular Formula | C25H31FO5S2 |
| Molecular Weight | 494.65 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 7-(4-cyclohexyl-3-fluoro-1,1-dioxo-2-sulfanylidenethiochromen-6-yl)oxyheptyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCCOc1ccc2c(c1)C(C1CCCCC1)=C(F)C(=S)S2(=O)=O |
| InChI | InChI=1S/C25H31FO5S2/c1-2-22(27)31-16-10-5-3-4-9-15-30-19-13-14-21-20(17-19)23(18-11-7-6-8-12-18)24(26)25(32)33(21,28)29/h2,13-14,17-18H,1,3-12,15-16H2 |
| InChIKey | CCCGTFSPWHACAM-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.65 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|